Difference between revisions of "Ec-05 006370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] == * smiles: ** CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC...")
(Created page with "Category:Gene == Gene Ec-05_006370 == * left end position: ** 8385529 * transcription direction: ** POSITIVE * right end position: ** 8412690 * centisome position: ** 92.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C3 C3] ==
+
== Gene Ec-05_006370 ==
−
* smiles:
+
* left end position:
−
** CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
+
** 8385529
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PFMVORMCVGOQKR-XNCOKRRHSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine
+
** 8412690
−
* molecular weight:
+
* centisome position:
−
** 1146.922    
+
** 92.113205    
 
* Synonym(s):
 
* Synonym(s):
−
** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala-D-Ala)
+
** Esi_0075_0055
−
** UDP-MurNAc-pentapeptide
+
** Esi0075_0055
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.5.1.98-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8975]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=8385529}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289103 86289103]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=8412690}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70758 70758]
+
{{#set: centisome position=92.113205   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0075_0055|Esi0075_0055}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04846 C04846]
+
{{#set: reaction associated=3.5.1.98-RXN}}
−
{{#set: smiles=CC(C(=O)NC(C([O-])=O)C)NC(=O)C(CCCC[N+])NC(=O)CCC(C(=O)[O-])NC(=O)C(C)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=PFMVORMCVGOQKR-XNCOKRRHSA-K}}
+
−
{{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanyl-D-alanine}}
+
−
{{#set: molecular weight=1146.922   }}
+
−
{{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala-D-Ala)|UDP-MurNAc-pentapeptide}}
+
−
{{#set: reversible reaction associated=RXN-8975}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-05_006370

  • left end position:
    • 8385529
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8412690
  • centisome position:
    • 92.113205
  • Synonym(s):
    • Esi_0075_0055
    • Esi0075_0055

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_006370&oldid=26938"