Difference between revisions of "PWY-6608"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6608 PWY-6608] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
+
 
* common name:
 
* common name:
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
+
** guanosine nucleotides degradation III
* molecular weight:
+
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
** (S)-3-hydroxy-12:1-Δ5-CoA
 
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17798]]
+
'''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-7609]]
* [[RXN-17797]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-05_000950]]
 +
*** [[Ec-15_000820]]
 +
*** [[Ec-12_005060]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN0-901]]
 +
** 2 associated gene(s):
 +
*** [[Ec-20_000230]]
 +
*** [[Ec-20_000210]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GUANINE-DEAMINASE-RXN GUANINE-DEAMINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5199 RXN0-5199]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6608 PWY-6608]
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=959.791    }}
+
{{#set: taxonomic range=TAX-33208}}
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
+
{{#set: common name=guanosine nucleotides degradation III}}
{{#set: consumed by=RXN-17798}}
+
{{#set: reaction found=2}}
{{#set: produced by=RXN-17797}}
+
{{#set: total reaction=4}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 19:26, 21 March 2018

Pathway PWY-6608

  • taxonomic range:
  • common name:
    • guanosine nucleotides degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links