Difference between revisions of "CPD-9039"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Acyl-ACPs Long-Chain-Acyl-ACPs] == * common name: ** a long-chain acyl-[acyl-carrier...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == |
+ | * smiles: | ||
+ | ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E | ||
* common name: | * common name: | ||
− | ** | + | ** cobalt-precorrin-2 |
+ | * molecular weight: | ||
+ | ** 912.701 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cobalt-dihydrosirohydrochlorin |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-8759]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790] | ||
+ | {{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}} | ||
+ | {{#set: common name=cobalt-precorrin-2}} | ||
+ | {{#set: molecular weight=912.701 }} | ||
+ | {{#set: common name=cobalt-dihydrosirohydrochlorin}} | ||
+ | {{#set: reversible reaction associated=RXN-8759}} |
Latest revision as of 19:26, 21 March 2018
Contents
Metabolite CPD-9039
- smiles:
- CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
- inchi key:
- InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
- common name:
- cobalt-precorrin-2
- molecular weight:
- 912.701
- Synonym(s):
- cobalt-dihydrosirohydrochlorin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-" cannot be used as a page name in this wiki.