Difference between revisions of "PWY-481"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] == * smiles: ** C([N+])CC1(=CC=CC=C1) * inchi key: ** InChIK...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-481 PWY-481] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-481 PWY-481] ==
* smiles:
+
* taxonomic range:
** C([N+])CC1(=CC=CC=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
* inchi key:
+
** InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** 2-phenylethylamine
+
** ethylbenzene degradation (anaerobic)
* molecular weight:
+
** 122.189   
+
 
* Synonym(s):
 
* Synonym(s):
** β-phenylethylamine
+
** anaerobic ethylbenzene oxidation
** phenylethylamine
+
** anaerobic ethylbenzene degradation
** phenethylamine
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[AMINEPHEN-RXN]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-1302]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-26_000120]]
 +
*** [[Ec-27_004280]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-2006]]
 +
** 1 associated gene(s):
 +
*** [[Ec-26_003940]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1301 RXN-1301]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1303 RXN-1303]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1304 RXN-1304]
 
== External links  ==
 
== External links  ==
* CAS : 64-04-0
+
* UM-BBD-PWY : ethb
* BIGG : 45591
+
{{#set: taxonomic range=TAX-1224}}
* DRUGBANK : DB04325
+
{{#set: common name=ethylbenzene degradation (anaerobic)}}
* PUBCHEM:
+
{{#set: common name=anaerobic ethylbenzene oxidation|anaerobic ethylbenzene degradation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448751 448751]
+
{{#set: reaction found=2}}
* HMDB : HMDB12275
+
{{#set: total reaction=5}}
* LIGAND-CPD:
+
{{#set: completion rate=40.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C05332 C05332]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.395457.html 395457]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=225237 225237]
+
* METABOLIGHTS : MTBLC225237
+
{{#set: smiles=C([N+])CC1(=CC=CC=C1)}}
+
{{#set: inchi key=InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O}}
+
{{#set: common name=2-phenylethylamine}}
+
{{#set: molecular weight=122.189    }}
+
{{#set: common name=β-phenylethylamine|phenylethylamine|phenethylamine}}
+
{{#set: consumed by=AMINEPHEN-RXN}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-481

  • taxonomic range:
  • common name:
    • ethylbenzene degradation (anaerobic)
  • Synonym(s):
    • anaerobic ethylbenzene oxidation
    • anaerobic ethylbenzene degradation

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

  • UM-BBD-PWY : ethb