Difference between revisions of "PWY-4983"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4983 PWY-4983] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4983 PWY-4983] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-citrulline-nitric oxide cycle |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-citrulline-NO cycle |
− | + | ** nitric oxide biosynthesis II | |
− | ** | + | |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''3''' reactions in the full pathway |
− | * [[RXN- | + | * [[ARGSUCCINLYA-RXN]] |
− | + | ** 1 associated gene(s): | |
− | * [[ | + | *** [[Ec-12_005890]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[ARGSUCCINSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-01_001870]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=NITRIC-OXIDE-SYNTHASE-RXN NITRIC-OXIDE-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=L-citrulline-nitric oxide cycle}} | |
− | + | {{#set: common name=L-citrulline-NO cycle|nitric oxide biosynthesis II}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:27, 21 March 2018
Pathway PWY-4983
- taxonomic range:
- common name:
- L-citrulline-nitric oxide cycle
- Synonym(s):
- L-citrulline-NO cycle
- nitric oxide biosynthesis II
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- ARGSUCCINLYA-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- ARGSUCCINSYN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: