Difference between revisions of "PWYQT-4429"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(OS(=O)(=O)[O-])C=C2)) * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4429 PWYQT-4429] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4429 PWYQT-4429] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** CO2 fixation into oxaloacetate (anaplerotic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''2''' reactions in the full pathway | |
| − | * [[ | + | * [[PEPCARBOX-RXN]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Ec-28_003470]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[RXN0-5224]] | ||
| + | ** 8 associated gene(s): | ||
| + | *** [[Ec-03_001960]] | ||
| + | *** [[Ec-10_002770]] | ||
| + | *** [[Ec-06_004120]] | ||
| + | *** [[Ec-05_001290]] | ||
| + | *** [[Ec-27_005680]] | ||
| + | *** [[Ec-07_004610]] | ||
| + | *** [[Ec-22_001150]] | ||
| + | *** [[Ec-16_004700]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-33090}} | |
| − | {{#set: | + | {{#set: common name=CO2 fixation into oxaloacetate (anaplerotic)}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: common name= | + | {{#set: total reaction=2}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:27, 21 March 2018
Pathway PWYQT-4429
- taxonomic range:
- common name:
- CO2 fixation into oxaloacetate (anaplerotic)
- Synonym(s):
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- PEPCARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN0-5224
- 8 associated gene(s):
- 1 reconstruction source(s) associated:
