Difference between revisions of "PWY-5189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * smiles: ** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-18...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5189 PWY-5189] ==
−
* smiles:
+
* taxonomic range:
−
** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1883 TAX-1883]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682]
−
** InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 
* common name:
 
* common name:
−
** butanoyl-CoA
+
** tetrapyrrole biosynthesis II (from glycine)
−
* molecular weight:
+
−
** 833.593   
+
 
* Synonym(s):
 
* Synonym(s):
−
** butyryl-CoA
 
−
** butyryl-coenzyme A
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-12565]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[OHMETHYLBILANESYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-25_002760]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PORPHOBILSYNTH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-00_001750]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[UROGENIIISYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-12_004890]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5-AMINOLEVULINIC-ACID-SYNTHASE-RXN 5-AMINOLEVULINIC-ACID-SYNTHASE-RXN]
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0023
+
{{#set: taxonomic range=TAX-1883}}
−
* CAS : 2140-48-9
+
{{#set: taxonomic range=TAX-33682}}
−
* BIGG : 33988
+
{{#set: taxonomic range=TAX-33630}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244513 25244513]
+
{{#set: taxonomic range=TAX-33208}}
−
* HMDB : HMDB01088
+
{{#set: taxonomic range=TAX-4751}}
−
* LIGAND-CPD:
+
{{#set: common name=tetrapyrrole biosynthesis II (from glycine)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00136 C00136]
+
{{#set: reaction found=3}}
−
* CHEBI:
+
{{#set: total reaction=4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57371 57371]
+
{{#set: completion rate=75.0}}
−
* METABOLIGHTS : MTBLC57371
+
−
{{#set: smiles=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J}}
+
−
{{#set: common name=butanoyl-CoA}}
+
−
{{#set: molecular weight=833.593    }}
+
−
{{#set: common name=butyryl-CoA|butyryl-coenzyme A}}
+
−
{{#set: consumed by=RXN-12565}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-5189

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5189&oldid=27025"