Difference between revisions of "CPD-2961"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.61-RXN 4.2.1.61-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == * smiles: ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O * inchi key: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2961 CPD-2961] == |
− | * | + | * smiles: |
− | ** | + | ** C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K |
− | ** | + | * common name: |
− | ** | + | ** D-gluconate 6-phosphate |
+ | * molecular weight: | ||
+ | ** 273.113 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 6-p gluconate |
− | ** | + | ** 6-phospho gluconate |
− | ** | + | ** 6-phosphogluconic acid |
− | ** | + | ** 6-phospho D-gluconate |
− | + | ||
− | + | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-9952]] |
− | + | * [[6PGLUCONDEHYDROG-RXN]] | |
− | * | + | * [[RXN-3341]] |
− | + | * [[PGLUCONDEHYDRAT-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[6PGLUCONOLACT-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * BIGG : 6pgc |
− | ** [http:// | + | * PUBCHEM: |
− | * | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688186 36688186] |
− | * | + | * HMDB : HMDB01316 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00345 C00345] |
− | ** [http://www. | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58759 58759] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58759 |
− | {{#set: | + | {{#set: smiles=C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K}} |
− | {{#set: common name= | + | {{#set: common name=D-gluconate 6-phosphate}} |
− | {{#set: | + | {{#set: molecular weight=273.113 }} |
− | + | {{#set: common name=6-p gluconate|6-phospho gluconate|6-phosphogluconic acid|6-phospho D-gluconate}} | |
− | {{#set: | + | {{#set: consumed by=RXN-9952|6PGLUCONDEHYDROG-RXN|RXN-3341|PGLUCONDEHYDRAT-RXN}} |
− | + | {{#set: produced by=6PGLUCONOLACT-RXN}} | |
− | + |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite CPD-2961
- smiles:
- C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O
- inchi key:
- InChIKey=BIRSGZKFKXLSJQ-SQOUGZDYSA-K
- common name:
- D-gluconate 6-phosphate
- molecular weight:
- 273.113
- Synonym(s):
- 6-p gluconate
- 6-phospho gluconate
- 6-phosphogluconic acid
- 6-phospho D-gluconate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 6pgc
- PUBCHEM:
- HMDB : HMDB01316
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58759
"C(C(C(C(C(C([O-])=O)O)O)O)O)OP([O-])([O-])=O" cannot be used as a page name in this wiki.