Difference between revisions of "PWY-6519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMMA-LINOLENOYL-COA GAMMA-LINOLENOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=XZQYPTBYQYZGRU-FHDVEODPSA-J
+
 
* common name:
 
* common name:
** γ-linolenoyl-CoA
+
** 8-amino-7-oxononanoate biosynthesis I
* molecular weight:
+
** 1023.921   
+
 
* Synonym(s):
 
* Synonym(s):
** (6Z,9Z,12Z)-octadeca-6,9,12-trienoyl-CoA
+
** 7-keto-8-aminopelargonate biosynthesis I
** (6Z,9Z,12Z)-octadecatrienoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''7''' reactions found over '''11''' reactions in the full pathway
* [[1.14.19.3-RXN]]
+
* [[RXN-11474]]
* [[RXN-16043]]
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11476]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11478]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11479]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11480]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11482]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11484]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_002200]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11475 RXN-11475]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11477 RXN-11477]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11483 RXN-11483]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* ECOCYC:
** [http://www.genome.jp/dbget-bin/www_bget?C03035 C03035]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6519 PWY-6519]
* CHEBI:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57363 57363]
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis I}}
* METABOLIGHTS : MTBLC57363
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis I}}
* PUBCHEM:
+
{{#set: reaction found=7}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266591 45266591]
+
{{#set: total reaction=11}}
* HMDB : HMDB06368
+
{{#set: completion rate=64.0}}
{{#set: smiles=CCCCCC=CCC=CCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=XZQYPTBYQYZGRU-FHDVEODPSA-J}}
+
{{#set: common name=γ-linolenoyl-CoA}}
+
{{#set: molecular weight=1023.921    }}
+
{{#set: common name=(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl-CoA|(6Z,9Z,12Z)-octadecatrienoyl-CoA}}
+
{{#set: produced by=1.14.19.3-RXN|RXN-16043}}
+

Latest revision as of 19:27, 21 March 2018

Pathway PWY-6519

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis I
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis I

Reaction(s) found

7 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links