Difference between revisions of "CPD-4"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_005040 == * left end position: ** 4317285 * transcription direction: ** POSITIVE * right end position: ** 4325015 * centisome position: ** 41.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == * smiles: ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4 CPD-4] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K |
| − | * | + | * common name: |
| − | ** | + | ** molybdopterin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 392.321 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** MPT |
| − | ** | + | ** pyranopterin-dithiolate |
| + | ** ene-dithiol pyranopterin | ||
| + | ** H2Dtpp-mP | ||
| + | ** [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8344]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-8342]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266731 45266731] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58698 58698] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05924 C05924] |
| + | * HMDB : HMDB02206 | ||
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))}} | ||
| + | {{#set: inchi key=InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K}} | ||
| + | {{#set: common name=molybdopterin}} | ||
| + | {{#set: molecular weight=392.321 }} | ||
| + | {{#set: common name=MPT|pyranopterin-dithiolate|ene-dithiol pyranopterin|H2Dtpp-mP|[(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate}} | ||
| + | {{#set: consumed by=RXN-8344}} | ||
| + | {{#set: produced by=RXN-8342}} | ||
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPD-4
- smiles:
- C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))
- inchi key:
- InChIKey=HPEUEJRPDGMIMY-IFQPEPLCSA-K
- common name:
- molybdopterin
- molecular weight:
- 392.321
- Synonym(s):
- MPT
- pyranopterin-dithiolate
- ene-dithiol pyranopterin
- H2Dtpp-mP
- [(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C([S-])=C(S)[CH]2([CH](O1)NC3(=C(N2)C(=O)NC(N)=N3)))" cannot be used as a page name in this wiki.
"(5aR,8R,9aR)-2-amino-4-oxo-6,7-disulfanyl-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogen phosphate" cannot be used as a page name in this wiki.
