Difference between revisions of "Ec-24 001990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * smiles: ** C(=O)(N)CCC([N+])C([O-])=O * inchi key: ** InChIKey=ZDXPYRJPNDTMRX-VKH...") |
(Created page with "Category:Gene == Gene Ec-24_001990 == * left end position: ** 2300897 * transcription direction: ** NEGATIVE * right end position: ** 2306186 * centisome position: ** 46.1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-24_001990 == |
− | * | + | * left end position: |
− | ** | + | ** 2300897 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2306186 |
− | * | + | * centisome position: |
− | ** | + | ** 46.131683 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0060_0046 |
− | ** | + | ** Esi0060_0046 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.5.1.27-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * | + | * Reaction: [[3.5.1.88-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2300897}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2306186}} | |
− | + | {{#set: centisome position=46.131683 }} | |
− | + | {{#set: common name=Esi_0060_0046|Esi0060_0046}} | |
− | + | {{#set: reaction associated=3.5.1.27-RXN|3.5.1.88-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:28, 21 March 2018
Gene Ec-24_001990
- left end position:
- 2300897
- transcription direction:
- NEGATIVE
- right end position:
- 2306186
- centisome position:
- 46.131683
- Synonym(s):
- Esi_0060_0046
- Esi0060_0046
Reactions associated
- Reaction: 3.5.1.27-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: 3.5.1.88-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome