Difference between revisions of "SHIKIMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] == * common name: ** a myristoyl-[acp] * Synonym(s): ** a tetrad...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
 +
* smiles:
 +
** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
 +
* inchi key:
 +
** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
 
* common name:
 
* common name:
** a myristoyl-[acp]
+
** shikimate
 +
* molecular weight:
 +
** 173.145   
 
* Synonym(s):
 
* Synonym(s):
** a tetradecanoyl-[acyl-carrier protein]
+
** shikimic acid
** a tetradecanoyl-[acp]
+
** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
** a myristoyl-[acyl-carrier protein]
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17017]]
+
* [[RXN-7968]]
* [[RXN-10727]]
+
* [[RXN-9654]]
+
* [[RXN-9539]]
+
* [[RXN-17022]]
+
* [[RXN-17024]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9662]]
+
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[SHIKIMATE-KINASE-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a myristoyl-[acp]}}
+
* CAS : 138-59-0
{{#set: common name=a tetradecanoyl-[acyl-carrier protein]|a tetradecanoyl-[acp]|a myristoyl-[acyl-carrier protein]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-17017|RXN-10727|RXN-9654|RXN-9539|RXN-17022|RXN-17024}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976]
{{#set: produced by=RXN-9662}}
+
* HMDB : HMDB03070
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208]
 +
* BIGG : 35144
 +
{{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}}
 +
{{#set: common name=shikimate}}
 +
{{#set: molecular weight=173.145    }}
 +
{{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}}
 +
{{#set: consumed by=RXN-7968}}
 +
{{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
 +
{{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN}}

Latest revision as of 20:28, 21 March 2018

Metabolite SHIKIMATE

  • smiles:
    • C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
  • inchi key:
    • InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
  • common name:
    • shikimate
  • molecular weight:
    • 173.145
  • Synonym(s):
    • shikimic acid
    • (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])" cannot be used as a page name in this wiki.