Difference between revisions of "PWY66-373"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * inchi key: ** InChIKey=HMFHBZSHGG...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY66-373 PWY66-373] ==
* smiles:
+
* taxonomic range:
** C(C1(C(C(C(O1)O)O)O))O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
* inchi key:
+
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
+
 
* common name:
 
* common name:
** α-D-ribofuranose
+
** sucrose degradation V (sucrose α-glucosidase)
* molecular weight:
+
** 150.131   
+
 
* Synonym(s):
 
* Synonym(s):
** α D-ribose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RIBOKIN-RXN]]
+
'''2''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-8631]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
* [[RXN-14904]]
+
*** [[Ec-10_004980]]
 +
*** [[Ec-10_000880]]
 +
*** [[Ec-14_001680]]
 +
*** [[Ec-01_008040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[TRIOSEPISOMERIZATION-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Ec-08_000500]]
 +
*** [[Ec-24_000360]]
 +
*** [[Ec-03_002790]]
 +
*** [[Ec-23_004160]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.48-RXN 3.2.1.48-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=KETOHEXOKINASE-RXN KETOHEXOKINASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=TRIOKINASE-RXN TRIOKINASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-40674}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
+
{{#set: common name=sucrose degradation V (sucrose α-glucosidase)}}
* CHEMSPIDER:
+
{{#set: reaction found=2}}
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
+
{{#set: total reaction=5}}
* CHEBI:
+
{{#set: completion rate=40.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
+
* HMDB : HMDB00283
+
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
+
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
+
{{#set: common name=α-D-ribofuranose}}
+
{{#set: molecular weight=150.131    }}
+
{{#set: common name=α D-ribose}}
+
{{#set: consumed by=RIBOKIN-RXN}}
+
{{#set: consumed or produced by=RXN-14904}}
+

Latest revision as of 19:00, 21 March 2018

Pathway PWY66-373

  • taxonomic range:
  • common name:
    • sucrose degradation V (sucrose α-glucosidase)
  • Synonym(s):

Reaction(s) found

2 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links