Difference between revisions of "RXN-14325"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14325 RXN-14325] == * direction: ** LEFT-TO-RIGHT * common name: ** CTP synthase * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14325 RXN-14325] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J
+
 
* common name:
 
* common name:
−
** 18-hydroxyoleoyl-CoA
+
** CTP synthase
−
* molecular weight:
+
−
** 1043.952   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (9Z)-18-hydroxyoctadec-9-enoyl-CoA
 
−
** ω-hydroxyoleoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-16117]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[UTP]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[AMMONIUM]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CTP]][c] '''+''' 1 [[Pi]][c] '''+''' 2 [[PROTON]][c]
−
* [[RXN-16402]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 UTP[c] '''+''' 1 ATP[c] '''+''' 1 ammonium[c] '''=>''' 1 ADP[c] '''+''' 1 CTP[c] '''+''' 1 phosphate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-20_000910]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_000570]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820566 91820566]
+
{{#set: common name=CTP synthase}}
−
* CHEBI:
+
{{#set: gene associated=Ec-20_000910|Ec-00_000570}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86044 86044]
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCCCCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=MQACSUXWIYYZAK-UTNXWDCOSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: common name=18-hydroxyoleoyl-CoA}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=1043.952    }}
+
−
{{#set: common name=(9Z)-18-hydroxyoctadec-9-enoyl-CoA|ω-hydroxyoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16117}}
+
−
{{#set: produced by=RXN-16402}}
+

Latest revision as of 19:28, 21 March 2018

Reaction RXN-14325

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • CTP synthase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 UTP[c] + 1 ATP[c] + 1 ammonium[c] => 1 ADP[c] + 1 CTP[c] + 1 phosphate[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14325&oldid=27142"