Difference between revisions of "Myristoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] == * smiles: ** CC(=O)NC(CCSC)C([O-])=O * inchi key: ** InChIKey=XUYPXLNMD...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] == * common name: ** a myristoyl-[acp] * Synonym(s): ** a tetrad...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2015 CPD0-2015] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myristoyl-ACPs Myristoyl-ACPs] ==
* smiles:
+
** CC(=O)NC(CCSC)C([O-])=O
+
* inchi key:
+
** InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M
+
 
* common name:
 
* common name:
** N-α-acetyl-L-methionine
+
** a myristoyl-[acp]
* molecular weight:
+
** 190.237   
+
 
* Synonym(s):
 
* Synonym(s):
** N-acetyl-L-methionine
+
** a tetradecanoyl-[acyl-carrier protein]
 +
** a tetradecanoyl-[acp]
 +
** a myristoyl-[acyl-carrier protein]
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-17017]]
 +
* [[RXN-10727]]
 +
* [[RXN-9654]]
 +
* [[RXN-9539]]
 +
* [[RXN-17022]]
 +
* [[RXN-17024]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-6948]]
+
* [[RXN-9662]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB01646
+
{{#set: common name=a myristoyl-[acp]}}
* PUBCHEM:
+
{{#set: common name=a tetradecanoyl-[acyl-carrier protein]|a tetradecanoyl-[acp]|a myristoyl-[acyl-carrier protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991985 6991985]
+
{{#set: consumed by=RXN-17017|RXN-10727|RXN-9654|RXN-9539|RXN-17022|RXN-17024}}
* HMDB : HMDB11745
+
{{#set: produced by=RXN-9662}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02712 C02712]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.395338.html 395338]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71670 71670]
+
{{#set: smiles=CC(=O)NC(CCSC)C([O-])=O}}
+
{{#set: inchi key=InChIKey=XUYPXLNMDZIRQH-LURJTMIESA-M}}
+
{{#set: common name=N-α-acetyl-L-methionine}}
+
{{#set: molecular weight=190.237    }}
+
{{#set: common name=N-acetyl-L-methionine}}
+
{{#set: produced by=RXN0-6948}}
+

Latest revision as of 19:28, 21 March 2018

Metabolite Myristoyl-ACPs

  • common name:
    • a myristoyl-[acp]
  • Synonym(s):
    • a tetradecanoyl-[acyl-carrier protein]
    • a tetradecanoyl-[acp]
    • a myristoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a myristoyl-[acp" cannot be used as a page name in this wiki.
  • "a tetradecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
  • "a tetradecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a myristoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.