Difference between revisions of "Ec-13 004620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] == * smiles: ** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=...")
(Created page with "Category:Gene == Gene Ec-13_004620 == * Synonym(s): ** Esi_0106_0087 ** Esi0106_0087 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17813 CPD-17813] ==
+
== Gene Ec-13_004620 ==
* smiles:
+
** CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
+
* inchi key:
+
** InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J
+
* common name:
+
** (2E,11Z)-hexadec-2,11-dienoyl-CoA
+
* molecular weight:
+
** 997.883   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0106_0087
 +
** Esi0106_0087
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16558]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0106_0087|Esi0106_0087}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819958 91819958]
+
{{#set: reaction associated=RXN-8443}}
{{#set: smiles=CCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}}
+
{{#set: pathway associated=PWY-5381}}
{{#set: inchi key=InChIKey=AMSSMXHTRODKSM-FYYFNCOUSA-J}}
+
{{#set: common name=(2E,11Z)-hexadec-2,11-dienoyl-CoA}}
+
{{#set: molecular weight=997.883    }}
+
{{#set: consumed by=RXN-16558}}
+

Latest revision as of 19:28, 21 March 2018

Gene Ec-13_004620

  • Synonym(s):
    • Esi_0106_0087
    • Esi0106_0087

Reactions associated

Pathways associated

External links