Difference between revisions of "PWY-6406"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6406 PWY-6406] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6406 PWY-6406] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J
+
 
* common name:
 
* common name:
−
** trans-caffeoyl-CoA
+
** salicylate biosynthesis I
−
* molecular weight:
+
−
** 925.647   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxyacryloyl-CoA
+
** salicylic acid biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ISOCHORSYN-RXN]]
−
* [[RXN-1126]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-05_002520]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1981 RXN-1981]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-3193}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266599 45266599]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: common name=salicylate biosynthesis I}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57372 57372]
+
{{#set: common name=salicylic acid biosynthesis}}
−
* LIGAND-CPD:
+
{{#set: reaction found=1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00323 C00323]
+
{{#set: total reaction=2}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=C(O)C(=C1)O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: completion rate=50.0}}
−
{{#set: inchi key=InChIKey=QHRGJMIMHCLHRG-ZSELIEHESA-J}}
+
−
{{#set: common name=trans-caffeoyl-CoA}}
+
−
{{#set: molecular weight=925.647    }}
+
−
{{#set: common name=3,4-dihydroxyacryloyl-CoA}}
+
−
{{#set: consumed by=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}}
+
−
{{#set: produced by=RXN-1126}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-6406

  • taxonomic range:
  • common name:
    • salicylate biosynthesis I
  • Synonym(s):
    • salicylic acid biosynthesis

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6406&oldid=27173"