Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** [CH](=O)CC([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-aspartate-semialdehyde |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 117.104 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-aspartic 4-semialdehyde |
| + | ** L-aspartate-4-semialdehyde | ||
| + | ** L-aspartate β-semialdehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[HOMOSERDEHYDROG-RXN]] |
| + | * [[DIHYDRODIPICSYN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 15106-57-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5287708 5287708] |
| − | * | + | * HMDB : HMDB12249 |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00441 C00441] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] |
| − | {{#set: inchi key=InChIKey= | + | * BIGG : 34990 |
| − | {{#set: common name= | + | {{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} |
| − | {{#set: common name= | + | {{#set: common name=L-aspartate-semialdehyde}} |
| − | {{#set: consumed by=RXN- | + | {{#set: molecular weight=117.104 }} |
| − | {{#set: | + | {{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} |
| + | {{#set: consumed by=HOMOSERDEHYDROG-RXN|DIHYDRODIPICSYN-RXN}} | ||
| + | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} | ||
Latest revision as of 20:28, 21 March 2018
Contents
Metabolite L-ASPARTATE-SEMIALDEHYDE
- smiles:
- [CH](=O)CC([N+])C(=O)[O-]
- inchi key:
- InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N
- common name:
- L-aspartate-semialdehyde
- molecular weight:
- 117.104
- Synonym(s):
- L-aspartic 4-semialdehyde
- L-aspartate-4-semialdehyde
- L-aspartate β-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
