Difference between revisions of "Ec-25 000050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Ec-25_000050 == * Synonym(s): ** Esi_0322_0008 ** Esi0322_0008 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Gene Ec-25_000050 ==
* smiles:
+
** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)
+
* inchi key:
+
** InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L
+
* common name:
+
** (2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
* molecular weight:
+
** 185.136   
+
 
* Synonym(s):
 
* Synonym(s):
** (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate
+
** Esi_0322_0008
 +
** Esi0322_0008
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14014]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
* [[DIHYDRODIPICSYN-RXN]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0322_0008|Esi0322_0008}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678847 70678847]
+
{{#set: reaction associated=RXN-8443}}
* CHEBI:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67139 67139]
+
{{#set: smiles=C1(C(O)CC(=NC1C([O-])=O)C([O-])=O)}}
+
{{#set: inchi key=InChIKey=DVTPRYHENFBCII-IMJSIDKUSA-L}}
+
{{#set: common name=(2S,4S)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
{{#set: molecular weight=185.136    }}
+
{{#set: common name=(4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate}}
+
{{#set: consumed by=RXN-14014}}
+
{{#set: produced by=DIHYDRODIPICSYN-RXN}}
+

Latest revision as of 19:28, 21 March 2018

Gene Ec-25_000050

  • Synonym(s):
    • Esi_0322_0008
    • Esi0322_0008

Reactions associated

Pathways associated

External links