Difference between revisions of "CPD-10277"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
 
* common name:
 
* common name:
−
** glycolysis II (from fructose 6-phosphate)
+
** lotaustralin
 +
* molecular weight:
 +
** 261.274   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''11''' reactions found over '''11''' reactions in the full pathway
+
* [[RXN-9674]]
−
* [[2PGADEHYDRAT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 3 associated gene(s):
+
* [[RXN-13603]]
−
*** [[Ec-27_004000]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-26_004120]]
+
−
*** [[Ec-14_005400]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[3PGAREARR-RXN]]
+
−
** 7 associated gene(s):
+
−
*** [[Ec-24_002670]]
+
−
*** [[Ec-03_002170]]
+
−
*** [[Ec-27_000330]]
+
−
*** [[Ec-03_002160]]
+
−
*** [[Ec-01_000980]]
+
−
*** [[Ec-06_009930]]
+
−
*** [[Ec-10_005410]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[6PFRUCTPHOS-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-12_002540]]
+
−
*** [[Ec-22_000070]]
+
−
*** [[Ec-14_003880]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[F16ALDOLASE-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-10_000880]]
+
−
*** [[Ec-10_004980]]
+
−
*** [[Ec-14_001680]]
+
−
*** [[Ec-01_008040]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[F16BDEPHOS-RXN]]
+
−
** 7 associated gene(s):
+
−
*** [[Ec-12_004070]]
+
−
*** [[Ec-04_004710]]
+
−
*** [[Ec-14_005760]]
+
−
*** [[Ec-06_004200]]
+
−
*** [[Ec-17_003090]]
+
−
*** [[Ec-21_001790]]
+
−
*** [[Ec-22_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[GAPOXNPHOSPHN-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-25_003550]]
+
−
*** [[Ec-19_001850]]
+
−
*** [[Ec-19_003020]]
+
−
*** [[Ec-08_000500]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPDEPHOS-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-26_004170]]
+
−
*** [[Ec-12_000950]]
+
−
*** [[Ec-06_006860]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[PEPSYNTH-RXN]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PHOSGLYPHOS-RXN]]
+
−
** 6 associated gene(s):
+
−
*** [[Ec-12_004530]]
+
−
*** [[Ec-01_001350]]
+
−
*** [[Ec-08_002400]]
+
−
*** [[Ec-12_004550]]
+
−
*** [[Ec-21_005710]]
+
−
*** [[Ec-21_004220]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
* [[RXN-15513]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[TRIOSEPISOMERIZATION-RXN]]
+
−
** 4 associated gene(s):
+
−
*** [[Ec-08_000500]]
+
−
*** [[Ec-23_004160]]
+
−
*** [[Ec-03_002790]]
+
−
*** [[Ec-24_000360]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5484 PWY-5484]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
−
{{#set: taxonomic range=TAX-2759}}
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
−
{{#set: taxonomic range=TAX-2157}}
+
* LIGAND-CPD:
−
{{#set: common name=glycolysis II (from fructose 6-phosphate)}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
−
{{#set: reaction found=11}}
+
* HMDB : HMDB33865
−
{{#set: total reaction=11}}
+
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
−
{{#set: completion rate=100.0}}
+
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
 +
{{#set: common name=lotaustralin}}
 +
{{#set: molecular weight=261.274    }}
 +
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
 +
{{#set: consumed by=RXN-9674}}
 +
{{#set: produced by=RXN-13603}}

Latest revision as of 19:29, 21 March 2018

Metabolite CPD-10277

  • smiles:
    • CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
  • inchi key:
    • InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
  • common name:
    • lotaustralin
  • molecular weight:
    • 261.274
  • Synonym(s):
    • 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10277&oldid=27212"