Difference between revisions of "Ec-27 005100"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
(Created page with "Category:Gene == Gene Ec-27_005100 == * left end position: ** 4611557 * transcription direction: ** NEGATIVE * right end position: ** 4627020 * centisome position: ** 71.4...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Gene Ec-27_005100 ==
−
* smiles:
+
* left end position:
−
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
+
** 4611557
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** glycerophosphoserine
+
** 4627020
−
* molecular weight:
+
* centisome position:
−
** 258.144    
+
** 71.49804    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0000_0259
 +
** Esi0000_0259
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14136]]
+
* Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4611557}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4627020}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
+
{{#set: centisome position=71.49804    }}
−
* BIGG : 1484554
+
{{#set: common name=Esi_0000_0259|Esi0000_0259}}
−
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
+
{{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}}
−
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
+
−
{{#set: common name=glycerophosphoserine}}
+
−
{{#set: molecular weight=258.144    }}
+
−
{{#set: consumed by=RXN-14136}}
+

Latest revision as of 19:29, 21 March 2018

Gene Ec-27_005100

  • left end position:
    • 4611557
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4627020
  • centisome position:
    • 71.49804
  • Synonym(s):
    • Esi_0000_0259
    • Esi0000_0259

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-27_005100&oldid=27256"