Difference between revisions of "PWY-7147"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7147 PWY-7147] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
 
* common name:
 
* common name:
** ω-saturated C55 dolichol phosphate
+
** 8-amino-7-oxononanoate biosynthesis II
* molecular weight:
+
** 849.311   
+
 
* Synonym(s):
 
* Synonym(s):
** ω-saturated dolichol-11 phosphate
+
** 7-keto-8-aminopelargonate biosynthesis II
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-16602]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-11484]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-04_002200]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13834 RXN-13834]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis II}}
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis II}}
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: reaction found=1}}
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: total reaction=2}}
{{#set: molecular weight=849.311    }}
+
{{#set: completion rate=50.0}}
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: consumed by=RXN-16602}}
+

Latest revision as of 19:08, 21 March 2018

Pathway PWY-7147

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis II
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis II

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links