Difference between revisions of "Ec-01 003570"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Ec-01_003570 == * left end position: ** 3001514 * transcription direction: ** NEGATIVE * right end position: ** 3006260 * centisome position: ** 29.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
+
== Gene Ec-01_003570 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
+
** 3001514
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** 3006260
−
* molecular weight:
+
* centisome position:
−
** 222.177    
+
** 29.087725    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0003_0279
 +
** Esi0003_0279
 +
** MCPK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10722]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[RXN-10721]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3001514}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3006260}}
−
** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009]
+
{{#set: centisome position=29.087725   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0003_0279|Esi0003_0279|MCPK}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* HMDB : HMDB04083
+
−
{{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}}
+
−
{{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
−
{{#set: molecular weight=222.177   }}
+
−
{{#set: consumed by=RXN-10722}}
+
−
{{#set: consumed or produced by=RXN-10721}}
+

Latest revision as of 20:08, 21 March 2018

Gene Ec-01_003570

  • left end position:
    • 3001514
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3006260
  • centisome position:
    • 29.087725
  • Synonym(s):
    • Esi_0003_0279
    • Esi0003_0279
    • MCPK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_003570&oldid=24855"