Difference between revisions of "18-HYDROXYOLEATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-chain-fatty-acids Very-long-chain-fatty-acids] == * common name: ** a very-long-chain...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] * inchi key:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=18-HYDROXYOLEATE 18-HYDROXYOLEATE] == |
| + | * smiles: | ||
| + | ** C(O)CCCCCCCC=CCCCCCCCC(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** 18-hydroxyoleate |
| + | * molecular weight: | ||
| + | ** 297.457 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 18-hydroxyoctadec-9-enoic acid |
| + | ** 18-hydroxy-9Z-octadecenoate | ||
| + | ** ω-hydroxy-9Z-octadecenoate | ||
| + | ** omega-hydroxy oleate | ||
| + | ** 18-hydroxy-(9Z)-oleate(1-) | ||
| + | ** ω-hydroxy-(9Z)-octadecenoate(1-) | ||
| + | ** ω-hydroxyoleate(1-) | ||
| + | ** (Z)-18-hydroxyoctadec-9-enoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16402]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289578 86289578] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78424 78424] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19616 C19616] | ||
| + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M}} | ||
| + | {{#set: common name=18-hydroxyoleate}} | ||
| + | {{#set: molecular weight=297.457 }} | ||
| + | {{#set: common name=18-hydroxyoctadec-9-enoic acid|18-hydroxy-9Z-octadecenoate|ω-hydroxy-9Z-octadecenoate|omega-hydroxy oleate|18-hydroxy-(9Z)-oleate(1-)|ω-hydroxy-(9Z)-octadecenoate(1-)|ω-hydroxyoleate(1-)|(Z)-18-hydroxyoctadec-9-enoic acid}} | ||
| + | {{#set: consumed by=RXN-16402}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite 18-HYDROXYOLEATE
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(=O)[O-]
- inchi key:
- InChIKey=LQUHZVLTTWMBTO-UPHRSURJSA-M
- common name:
- 18-hydroxyoleate
- molecular weight:
- 297.457
- Synonym(s):
- 18-hydroxyoctadec-9-enoic acid
- 18-hydroxy-9Z-octadecenoate
- ω-hydroxy-9Z-octadecenoate
- omega-hydroxy oleate
- 18-hydroxy-(9Z)-oleate(1-)
- ω-hydroxy-(9Z)-octadecenoate(1-)
- ω-hydroxyoleate(1-)
- (Z)-18-hydroxyoctadec-9-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)CCCCCCCC=CCCCCCCCC(=O)[O-" cannot be used as a page name in this wiki.
