Difference between revisions of "PWY-7426"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * smiles: ** C([Se]CC(C([O-])=O)[N+])CC([N+])C(=O)[O-] * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7426 PWY-7426] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7426 PWY-7426] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** mannosyl-glycoprotein N-acetylglucosaminyltransferases |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''7''' reactions found over '''7''' reactions in the full pathway |
| − | + | * [[2.4.1.101-RXN]] | |
| − | + | ** 2 associated gene(s): | |
| − | * [[RXN- | + | *** [[Ec-23_001370]] |
| + | *** [[Ec-08_002720]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[2.4.1.143-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[2.4.1.144-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[2.4.1.145-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Ec-07_006930]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[2.4.1.155-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[2.4.1.201-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | * [[3.2.1.114-RXN]] | ||
| + | ** 0 associated gene: | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=mannosyl-glycoprotein N-acetylglucosaminyltransferases}} | |
| − | + | {{#set: reaction found=7}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=100.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:29, 21 March 2018
Pathway PWY-7426
- taxonomic range:
- common name:
- mannosyl-glycoprotein N-acetylglucosaminyltransferases
- Synonym(s):
Reaction(s) found
7 reactions found over 7 reactions in the full pathway
- 2.4.1.101-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- 2.4.1.143-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 2.4.1.144-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 2.4.1.145-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- 2.4.1.155-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 2.4.1.201-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 3.2.1.114-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
