Difference between revisions of "CPD-12258"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHTYOSPHINGOSINE-1-P PHTYOSPHINGOSINE-1-P] == * smiles: ** CCCCCCCCCCCCCCC(O)C(C(COP([O-])(=O)[...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == * smiles: ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12258 CPD-12258] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K |
* common name: | * common name: | ||
− | ** | + | ** UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1075.843 |
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala) |
+ | ** UDP-MurNAc-tetrapeptide | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11347]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658175 90658175] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06432 C06432] |
− | + | {{#set: smiles=CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine}} |
− | {{#set: common name= | + | {{#set: molecular weight=1075.843 }} |
− | {{#set: molecular weight= | + | {{#set: common name=UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)|UDP-MurNAc-tetrapeptide}} |
− | {{#set: common name=( | + | {{#set: consumed by=RXN-11347}} |
− | {{#set: consumed by=RXN- | + |
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite CPD-12258
- smiles:
- CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)
- inchi key:
- InChIKey=FOEDSVRZGQIXSP-XSOIKTQOSA-K
- common name:
- UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-L-lysyl-D-alanine
- molecular weight:
- 1075.843
- Synonym(s):
- UDP-Mur2Ac(oyl-L-Ala-g-D-Glu-L-Lys-D-Ala)
- UDP-MurNAc-tetrapeptide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)NC(C(=O)[O-])CCC(=O)NC(CCCC[N+])C(NC(C)C(=O)[O-])=O)NC(=O)C(C)OC1(C(O)C(CO)OC(C(NC(=O)C)1)OP(OP(OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)([O-])=O)" cannot be used as a page name in this wiki.