Difference between revisions of "Ec-12 005890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] == * smiles: ** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Gene == Gene Ec-12_005890 == * left end position: ** 5352687 * transcription direction: ** POSITIVE * right end position: ** 5359178 * centisome position: ** 64.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15364 CPD-15364] ==
+
== Gene Ec-12_005890 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 5352687
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ricinoleoyl-CoA
+
** 5359178
−
* molecular weight:
+
* centisome position:
−
** 1043.952    
+
** 64.211296    
 
* Synonym(s):
 
* Synonym(s):
−
** 12-hydroxy-9-octadecenoyl-CoA
+
** Esi_0081_0083
 +
** Esi0081_0083
 +
** ASL
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ARGSUCCINLYA-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-16151]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-22]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-4984]]
 +
* [[PWY-5]]
 +
* [[ARGSYN-PWY]]
 +
* [[PWY-5154]]
 +
* [[ARGSYNBSUB-PWY]]
 +
* [[PWY-4983]]
 +
* [[PWY-7400]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5352687}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658767 90658767]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC(O)CC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=5359178}}
−
{{#set: inchi key=InChIKey=BHVZCCKRRPYXCV-MGNVXPIMSA-J}}
+
{{#set: centisome position=64.211296   }}
−
{{#set: common name=ricinoleoyl-CoA}}
+
{{#set: common name=Esi_0081_0083|Esi0081_0083|ASL}}
−
{{#set: molecular weight=1043.952   }}
+
{{#set: reaction associated=ARGSUCCINLYA-RXN|RXN-22}}
−
{{#set: common name=12-hydroxy-9-octadecenoyl-CoA}}
+
{{#set: pathway associated=PWY-4984|PWY-5|ARGSYN-PWY|PWY-5154|ARGSYNBSUB-PWY|PWY-4983|PWY-7400}}
−
{{#set: reversible reaction associated=RXN-16151}}
+

Latest revision as of 19:30, 21 March 2018

Gene Ec-12_005890

  • left end position:
    • 5352687
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5359178
  • centisome position:
    • 64.211296
  • Synonym(s):
    • Esi_0081_0083
    • Esi0081_0083
    • ASL

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_005890&oldid=27402"