Difference between revisions of "PWY0-1335"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1335 PWY0-1335] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1335 PWY0-1335] ==
* smiles:
+
* taxonomic range:
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(9Z)-hexadecenoyl-CoA
+
** NADH to cytochrome bo oxidase electron transfer I
* molecular weight:
+
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-16:1-Δ9-CoA
 
** 3-oxo-9-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-17790]]
+
* [[NADH-DEHYDROG-A-RXN]]
== Reaction(s) of unknown directionality ==
+
** 15 associated gene(s):
 +
*** [[Ec-21_001150]]
 +
*** [[Ec-19_001720]]
 +
*** [[Ec-20_001030]]
 +
*** [[Ec-08_005450]]
 +
*** [[Ec-01_000420]]
 +
*** [[Ec-21_003400]]
 +
*** [[Ec-10_001380]]
 +
*** [[Ec-02_006350]]
 +
*** [[Ec-21_004880]]
 +
*** [[Ec-06_007580]]
 +
*** [[Ec-10_005810]]
 +
*** [[Ec-03_000900]]
 +
*** [[Ec-18_003900]]
 +
*** [[Ec-01_008630]]
 +
*** [[Ec-05_005740]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-5268 RXN0-5268]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1335 PWY0-1335]
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: molecular weight=1013.883    }}
+
{{#set: common name=NADH to cytochrome bo oxidase electron transfer I}}
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN-17790}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 19:30, 21 March 2018

Pathway PWY0-1335

  • taxonomic range:
  • common name:
    • NADH to cytochrome bo oxidase electron transfer I
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links