Difference between revisions of "PWY-5035"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))OP(OP([O-])([O-])=O)([O-])=O *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3195 TAX-3195] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** gibberellin biosynthesis III (early C-13 hydroxylation) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''2''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | * [[RXN1F-167]] |
− | * [[ | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[Ec-19_002750]] |
− | + | *** [[Ec-08_003510]] | |
− | * [[ | + | *** [[Ec-19_002760]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-aragem]] |
− | * [[ | + | * [[RXN1F-168]] |
− | == Reaction(s) | + | ** 3 associated gene(s): |
+ | *** [[Ec-08_003510]] | ||
+ | *** [[Ec-19_002750]] | ||
+ | *** [[Ec-19_002760]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-6524 RXN-6524] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-101 RXN1F-101] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-143 RXN1F-143] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-169 RXN1F-169] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-170 RXN1F-170] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5035 PWY-5035] | |
− | + | {{#set: taxonomic range=TAX-58023}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-3195}} |
− | + | {{#set: common name=gibberellin biosynthesis III (early C-13 hydroxylation)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=29.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:31, 21 March 2018
Pathway PWY-5035
- taxonomic range:
- common name:
- gibberellin biosynthesis III (early C-13 hydroxylation)
- Synonym(s):
Reaction(s) found
2 reactions found over 7 reactions in the full pathway
- RXN1F-167
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN1F-168
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: