Difference between revisions of "Ec-17 002250"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...") |
(Created page with "Category:Gene == Gene Ec-17_002250 == * left end position: ** 2380728 * transcription direction: ** POSITIVE * right end position: ** 2386933 * centisome position: ** 49.6...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_002250 == |
− | * | + | * left end position: |
− | ** | + | ** 2380728 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2386933 |
− | * | + | * centisome position: |
− | ** | + | ** 49.61972 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0026_0050 |
− | ** | + | ** Esi0026_0050 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[3.2.1.113-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=2380728}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2386933}} | |
− | + | {{#set: centisome position=49.61972 }} | |
− | + | {{#set: common name=Esi_0026_0050|Esi0026_0050}} | |
− | + | {{#set: reaction associated=3.2.1.113-RXN}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-17_002250
- left end position:
- 2380728
- transcription direction:
- POSITIVE
- right end position:
- 2386933
- centisome position:
- 49.61972
- Synonym(s):
- Esi_0026_0050
- Esi0026_0050
Reactions associated
- Reaction: 3.2.1.113-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome