Difference between revisions of "Ec-17 002250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * smiles: ** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * inchi k...")
(Created page with "Category:Gene == Gene Ec-17_002250 == * left end position: ** 2380728 * transcription direction: ** POSITIVE * right end position: ** 2386933 * centisome position: ** 49.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] ==
+
== Gene Ec-17_002250 ==
−
* smiles:
+
* left end position:
−
** C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 2380728
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** S-sulfanylglutathione
+
** 2386933
−
* molecular weight:
+
* centisome position:
−
** 338.373    
+
** 49.61972    
 
* Synonym(s):
 
* Synonym(s):
−
** GSSH
+
** Esi_0026_0050
−
** glutathione-sulfide
+
** Esi0026_0050
−
** glutathione persulfide
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.113-RXN]]
−
* [[RXN-15348]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
−
* [[RXN-10851]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2380728}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878477 46878477]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2386933}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58905 58905]
+
{{#set: centisome position=49.61972   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0026_0050|Esi0026_0050}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C17267 C17267]
+
{{#set: reaction associated=3.2.1.113-RXN}}
−
{{#set: smiles=C(SS)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=QBOLVLBSUGJHGB-WDSKDSINSA-M}}
+
−
{{#set: common name=S-sulfanylglutathione}}
+
−
{{#set: molecular weight=338.373   }}
+
−
{{#set: common name=GSSH|glutathione-sulfide|glutathione persulfide}}
+
−
{{#set: produced by=RXN-15348}}
+
−
{{#set: reversible reaction associated=RXN-10851}}
+

Latest revision as of 19:31, 21 March 2018

Gene Ec-17_002250

  • left end position:
    • 2380728
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2386933
  • centisome position:
    • 49.61972
  • Synonym(s):
    • Esi_0026_0050
    • Esi0026_0050

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_002250&oldid=27515"