Difference between revisions of "Ec-21 001540"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-787 CPD-787] == * smiles: ** C([O-])(=O)CC=CC=C(O)C(=O)[O-] * inchi key: ** InChIKey=ZBCBET...") |
(Created page with "Category:Gene == Gene Ec-21_001540 == * left end position: ** 2533076 * transcription direction: ** NEGATIVE * right end position: ** 2534742 * centisome position: ** 34.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_001540 == |
− | * | + | * left end position: |
− | ** | + | ** 2533076 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2534742 |
− | * | + | * centisome position: |
− | ** | + | ** 34.322968 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0025_0150 |
− | ** | + | ** Esi0025_0150 |
− | ** | + | ** FKB4 |
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2533076}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2534742}} | |
− | + | {{#set: centisome position=34.322968 }} | |
− | + | {{#set: common name=Esi_0025_0150|Esi0025_0150|FKB4}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-21_001540
- left end position:
- 2533076
- transcription direction:
- NEGATIVE
- right end position:
- 2534742
- centisome position:
- 34.322968
- Synonym(s):
- Esi_0025_0150
- Esi0025_0150
- FKB4
Reactions associated
- Reaction: PEPTIDYLPROLYL-ISOMERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome