Difference between revisions of "Ec-12 006780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...")
(Created page with "Category:Gene == Gene Ec-12_006780 == * left end position: ** 6114602 * transcription direction: ** NEGATIVE * right end position: ** 6128838 * centisome position: ** 73.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+
== Gene Ec-12_006780 ==
−
* smiles:
+
* left end position:
−
** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])
+
** 6114602
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 9-mercaptodethiobiotin
+
** 6128838
−
* molecular weight:
+
* centisome position:
−
** 245.316    
+
** 73.351295    
 
* Synonym(s):
 
* Synonym(s):
−
** 9-mercaptodesthiobiotin
+
** Esi_0226_0050
 +
** Esi0226_0050
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[L-LACTATE-DEHYDROGENASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17473]]
+
*** Assignment: go-term
−
* [[RXN-17472]]
+
== Pathways associated ==
 +
* [[P122-PWY]]
 +
* [[PWY-5481]]
 +
* [[P124-PWY]]
 +
* [[PWY-6901]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6114602}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244092 25244092]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-])}}
+
{{#set: right end position=6128838}}
−
{{#set: inchi key=InChIKey=ZARFDBYKHCOTRH-UHFFFAOYSA-M}}
+
{{#set: centisome position=73.351295   }}
−
{{#set: common name=9-mercaptodethiobiotin}}
+
{{#set: common name=Esi_0226_0050|Esi0226_0050}}
−
{{#set: molecular weight=245.316   }}
+
{{#set: reaction associated=L-LACTATE-DEHYDROGENASE-RXN}}
−
{{#set: common name=9-mercaptodesthiobiotin}}
+
{{#set: pathway associated=P122-PWY|PWY-5481|P124-PWY|PWY-6901}}
−
{{#set: reversible reaction associated=RXN-17473|RXN-17472}}
+

Latest revision as of 20:31, 21 March 2018

Gene Ec-12_006780

  • left end position:
    • 6114602
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6128838
  • centisome position:
    • 73.351295
  • Synonym(s):
    • Esi_0226_0050
    • Esi0226_0050

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_006780&oldid=27526"