Difference between revisions of "Ec-12 006780"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * smiles: ** C(S)C1(C(NC(N1)=O)CCCCCC(=O)[O-]) * inchi key: ** InChIKey=Z...") |
(Created page with "Category:Gene == Gene Ec-12_006780 == * left end position: ** 6114602 * transcription direction: ** NEGATIVE * right end position: ** 6128838 * centisome position: ** 73.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_006780 == |
− | * | + | * left end position: |
− | ** | + | ** 6114602 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 6128838 |
− | * | + | * centisome position: |
− | ** | + | ** 73.351295 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0226_0050 |
+ | ** Esi0226_0050 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[L-LACTATE-DEHYDROGENASE-RXN]] | |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: go-term |
− | * [[ | + | == Pathways associated == |
+ | * [[P122-PWY]] | ||
+ | * [[PWY-5481]] | ||
+ | * [[P124-PWY]] | ||
+ | * [[PWY-6901]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=6114602}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=6128838}} |
− | {{#set: | + | {{#set: centisome position=73.351295 }} |
− | {{#set: | + | {{#set: common name=Esi_0226_0050|Esi0226_0050}} |
− | {{#set: | + | {{#set: reaction associated=L-LACTATE-DEHYDROGENASE-RXN}} |
− | {{#set: common name= | + | {{#set: pathway associated=P122-PWY|PWY-5481|P124-PWY|PWY-6901}} |
− | {{#set: | + |
Latest revision as of 19:31, 21 March 2018
Gene Ec-12_006780
- left end position:
- 6114602
- transcription direction:
- NEGATIVE
- right end position:
- 6128838
- centisome position:
- 73.351295
- Synonym(s):
- Esi_0226_0050
- Esi0226_0050
Reactions associated
- Reaction: L-LACTATE-DEHYDROGENASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome