Difference between revisions of "RXN-14189"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14189 RXN-14189] == * direction: ** REVERSIBLE * common name: ** Catalase-peroxidase haem ** Ca...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUMP DUMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14189 RXN-14189] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L
+
 
* common name:
 
* common name:
−
** dUMP
+
** Catalase-peroxidase haem
−
* molecular weight:
+
** Catalase
−
** 306.168   
+
** Haem peroxidase, plant/fungal/bacterial
 +
** catalase/peroxidase
 +
** Haem peroxidase
 +
** Catalase core domain
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.6 EC-1.11.1.6]
 
* Synonym(s):
 
* Synonym(s):
−
** U
 
−
** deoxyurdine-phosphate
 
−
** 2'-deoxyuridine 5-monophosphate
 
−
** deoxyuridine-phosphate
 
−
** 2'-deoxyuridine 5'-phosphate
 
−
** 2'-deoxyuridylic acid
 
−
** 2'-deoxy-5'-uridylic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[THYMIDYLATESYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[METOH]][c] '''<=>''' 2 [[WATER]][c] '''+''' 1 [[FORMALDEHYDE]][c]
−
* [[DUTP-PYROP-RXN]]
+
* With common name(s):
−
* [[RXN-14199]]
+
** 1 hydrogen peroxide[c] '''+''' 1 methanol[c] '''<=>''' 2 H2O[c] '''+''' 1 formaldehyde[c]
−
* [[DCMP-DEAMINASE-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[RXN-14220]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_003410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-02_000470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_008210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_010030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-05_003380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-07_004600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-07_001420]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-00_008230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-00_008240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 964-26-1
+
* LIGAND-RXN:
−
* BIGG : 34762
+
** [http://www.genome.jp/dbget-bin/www_bget?R00602 R00602]
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=18601100 18601100]
+
{{#set: common name=Catalase-peroxidase haem}}
−
* HMDB : HMDB01409
+
{{#set: common name=Catalase}}
−
* LIGAND-CPD:
+
{{#set: common name=Haem peroxidase, plant/fungal/bacterial}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00365 C00365]
+
{{#set: common name=catalase/peroxidase}}
−
* CHEMSPIDER:
+
{{#set: common name=Haem peroxidase}}
−
** [http://www.chemspider.com/Chemical-Structure.18555972.html 18555972]
+
{{#set: common name=Catalase core domain}}
−
* CHEBI:
+
{{#set: ec number=EC-1.11.1.6}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=246422 246422]
+
{{#set: gene associated=Ec-11_003410|Ec-02_000470|Ec-00_008210|Ec-00_010030|Ec-05_003380|Ec-07_004600|Ec-07_001420|Ec-00_008230|Ec-00_008240}}
−
* METABOLIGHTS : MTBLC246422
+
{{#set: in pathway=}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=JSRLJPSBLDHEIO-SHYZEUOFSA-L}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
−
{{#set: common name=dUMP}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=306.168    }}
+
−
{{#set: common name=U|deoxyurdine-phosphate|2'-deoxyuridine 5-monophosphate|deoxyuridine-phosphate|2'-deoxyuridine 5'-phosphate|2'-deoxyuridylic acid|2'-deoxy-5'-uridylic acid}}
+
−
{{#set: consumed by=THYMIDYLATESYN-RXN}}
+
−
{{#set: produced by=DUTP-PYROP-RXN|RXN-14199|DCMP-DEAMINASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN-14220}}
+

Latest revision as of 19:31, 21 March 2018

Reaction RXN-14189

  • direction:
    • REVERSIBLE
  • common name:
    • Catalase-peroxidase haem
    • Catalase
    • Haem peroxidase, plant/fungal/bacterial
    • catalase/peroxidase
    • Haem peroxidase
    • Catalase core domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links







Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-14189&oldid=27535"