Difference between revisions of "PHOSNACMURPENTATRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSNACMURPENTATRANS-RXN PHOSNACMURPENTATRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PHOSNACMURPENTATRANS-RXN PHOSNACMURPENTATRANS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine:undecaprenyl-phosphate transferase |
− | * | + | ** phospho-N-acetylmuramoyl-pentapeptide-transferase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.7.8.13 EC-2.7.8.13] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | == | + | ** 1 [[CPD-9646]][c] '''+''' 1 [[C1]][c] '''=>''' 1 [[C5]][c] '''+''' 1 [[UMP]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 di-trans,octa-cis-undecaprenyl phosphate[c] '''+''' 1 UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine[c] '''=>''' 1 undecaprenyldiphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine[c] '''+''' 1 UMP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-07_007020]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PEPTIDOGLYCANSYN-PWY]], peptidoglycan biosynthesis I (meso-diaminopimelate containing): [http://metacyc.org/META/NEW-IMAGE?object=PEPTIDOGLYCANSYN-PWY PEPTIDOGLYCANSYN-PWY] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28386 28386] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R05630 R05630] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q55986 Q55986] |
− | * | + | ** [http://www.uniprot.org/uniprot/P45062 P45062] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q03521 Q03521] |
− | * | + | ** [http://www.uniprot.org/uniprot/O25235 O25235] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JSZ3 Q9JSZ3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PI72 Q9PI72] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P37585 P37585] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P0A6W3 P0A6W3] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine:undecaprenyl-phosphate transferase}} |
+ | {{#set: common name=phospho-N-acetylmuramoyl-pentapeptide-transferase}} | ||
+ | {{#set: ec number=EC-2.7.8.13}} | ||
+ | {{#set: gene associated=Ec-07_007020}} | ||
+ | {{#set: in pathway=PEPTIDOGLYCANSYN-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:31, 21 March 2018
Contents
Reaction PHOSNACMURPENTATRANS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- UDP-N-acetylmuramoyl-L-alanyl-D-glutamyl-meso-2,6-diaminopimelyl-D-alanyl-D-alanine:undecaprenyl-phosphate transferase
- phospho-N-acetylmuramoyl-pentapeptide-transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 di-trans,octa-cis-undecaprenyl phosphate[c] + 1 UDP-N-acetyl-α-D-muramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine[c] => 1 undecaprenyldiphospho-N-acetylmuramoyl-L-alanyl-γ-D-glutamyl-meso-2,6-diaminopimeloyl-D-alanyl-D-alanine[c] + 1 UMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-07_007020
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PEPTIDOGLYCANSYN-PWY, peptidoglycan biosynthesis I (meso-diaminopimelate containing): PEPTIDOGLYCANSYN-PWY
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links