Difference between revisions of "CPD-7524"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]
+
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
 +
* inchi key:
 +
** InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
 
* common name:
 
* common name:
−
** isoflavonoid biosynthesis I
+
** 7,9,9'-cis-neurosporene
 +
* molecular weight:
 +
** 538.898   
 
* Synonym(s):
 
* Synonym(s):
 +
** proneurosporene
 +
** 7,9,9'-tri-cis-neurosporene
 +
** 7,9,9'-tricis-neurosporene
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN-11357]]
−
* [[RXN-3221]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[RXN-11356]]
−
*** [[Ec-00_005930]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-05_001880]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3283 RXN-3283]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3284 RXN-3284]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3481 RXN-3481]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3501 RXN-3501]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-3803}}
+
* LIGAND-CPD:
−
{{#set: common name=isoflavonoid biosynthesis I}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C19759 C19759]
−
{{#set: reaction found=1}}
+
* CHEBI:
−
{{#set: total reaction=5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62463 62463]
−
{{#set: completion rate=20.0}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244751 25244751]
 +
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C}}
 +
{{#set: inchi key=InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N}}
 +
{{#set: common name=7,9,9'-cis-neurosporene}}
 +
{{#set: molecular weight=538.898    }}
 +
{{#set: common name=proneurosporene|7,9,9'-tri-cis-neurosporene|7,9,9'-tricis-neurosporene}}
 +
{{#set: consumed by=RXN-11357}}
 +
{{#set: produced by=RXN-11356}}

Latest revision as of 20:31, 21 March 2018

Metabolite CPD-7524

  • smiles:
    • CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)CCC=C(CCC=C(C)C)C)C)C)C)C
  • inchi key:
    • InChIKey=ATCICVFRSJQYDV-IFJQPPEWSA-N
  • common name:
    • 7,9,9'-cis-neurosporene
  • molecular weight:
    • 538.898
  • Synonym(s):
    • proneurosporene
    • 7,9,9'-tri-cis-neurosporene
    • 7,9,9'-tricis-neurosporene

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7524&oldid=27550"