Difference between revisions of "INDOXYL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5137 PWY-5137] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] == * smiles: ** C2(C=CC1(=C(C(O)=CN1)C=2)) * inchi key: ** InChIKey=PCKPVGOLPK...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5137 PWY-5137] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOXYL INDOXYL] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C2(C=CC1(=C(C(O)=CN1)C=2))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
+
* inchi key:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** fatty acid β-oxidation III (unsaturated, odd number)
+
** indoxyl
 +
* molecular weight:
 +
** 133.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** indole-3-ol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
* [[ENOYL-COA-DELTA-ISOM-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** 1 associated gene(s):
+
* [[RXN-15587]]
−
*** [[Ec-20_003150]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* PUBCHEM:
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5137 PWY-5137]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50591 50591]
−
{{#set: taxonomic range=TAX-2}}
+
* CHEMSPIDER:
−
{{#set: taxonomic range=TAX-2157}}
+
** [http://www.chemspider.com/Chemical-Structure.45861.html 45861]
−
{{#set: taxonomic range=TAX-2759}}
+
* CHEBI:
−
{{#set: common name=fatty acid β-oxidation III (unsaturated, odd number)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17840 17840]
−
{{#set: reaction found=1}}
+
* LIGAND-CPD:
−
{{#set: total reaction=1}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05658 C05658]
−
{{#set: completion rate=100.0}}
+
* HMDB : HMDB04094
 +
{{#set: smiles=C2(C=CC1(=C(C(O)=CN1)C=2))}}
 +
{{#set: inchi key=InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N}}
 +
{{#set: common name=indoxyl}}
 +
{{#set: molecular weight=133.149    }}
 +
{{#set: common name=indole-3-ol}}
 +
{{#set: reversible reaction associated=RXN-15587}}

Latest revision as of 19:32, 21 March 2018

Metabolite INDOXYL

  • smiles:
    • C2(C=CC1(=C(C(O)=CN1)C=2))
  • inchi key:
    • InChIKey=PCKPVGOLPKLUHR-UHFFFAOYSA-N
  • common name:
    • indoxyl
  • molecular weight:
    • 133.149
  • Synonym(s):
    • indole-3-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=INDOXYL&oldid=27556"