Difference between revisions of "PWY-7197"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1133 CPD0-1133] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7197 PWY-7197] ==
* smiles:
+
* taxonomic range:
** C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** maltoheptaose
+
** pyrimidine deoxyribonucleotide phosphorylation
* molecular weight:
+
** 1153.009   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14283]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[DCDPKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 7 associated gene(s):
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-11_005170]]
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTDPKIN-RXN]]
 +
** 7 associated gene(s):
 +
*** [[Ec-26_003930]]
 +
*** [[Ec-07_000140]]
 +
*** [[Ec-03_001380]]
 +
*** [[Ec-22_003280]]
 +
*** [[Ec-04_001140]]
 +
*** [[Ec-11_004330]]
 +
*** [[Ec-11_005170]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[DTMPKI-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-20_004950]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7913]]
 +
** 4 associated gene(s):
 +
*** [[Ec-14_004920]]
 +
*** [[Ec-16_005090]]
 +
*** [[Ec-06_003080]]
 +
*** [[Ec-07_003680]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* ECOCYC:
** [http://www.genome.jp/dbget-bin/www_bget?G00689 G00689]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7197 PWY-7197]
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61954 61954]
+
{{#set: taxonomic range=TAX-2}}
* METABOLIGHTS : MTBLC61954
+
{{#set: taxonomic range=TAX-2157}}
* PUBCHEM:
+
{{#set: common name=pyrimidine deoxyribonucleotide phosphorylation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13908996 13908996]
+
{{#set: reaction found=4}}
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC2(C(O)C(O)C(OC(CO)2)OC3(C(O)C(O)C(OC(CO)3)OC7(C(O)C(O)C(OC6(C(O)C(O)C(OC4(C(O)C(O)C(OC(CO)4)OC5(C(O)C(O)C(O)OC(CO)5)))OC(CO)6))OC(CO)7))))}}
+
{{#set: total reaction=4}}
{{#set: inchi key=InChIKey=BNABBHGYYMZMOA-QJBBZCPBSA-N}}
+
{{#set: completion rate=100.0}}
{{#set: common name=maltoheptaose}}
+
{{#set: molecular weight=1153.009    }}
+
{{#set: consumed by=RXN-14283}}
+

Latest revision as of 19:32, 21 March 2018

Pathway PWY-7197

  • taxonomic range:
  • common name:
    • pyrimidine deoxyribonucleotide phosphorylation
  • Synonym(s):

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links