Difference between revisions of "PWY-7344"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7344 PWY-7344] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7344 PWY-7344] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
* common name: | * common name: | ||
| − | ** | + | ** UDP-D-galactose biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
| − | * [[ | + | * [[UDPGLUCEPIM-RXN]] |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Ec-04_000280]] | ||
| + | *** [[Ec-04_004180]] | ||
| + | *** [[Ec-05_006710]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-7344 PWY-7344] |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2759}} |
| − | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
| − | {{#set: common name= | + | {{#set: taxonomic range=TAX-2157}} |
| − | {{#set: | + | {{#set: common name=UDP-D-galactose biosynthesis}} |
| − | {{#set: | + | {{#set: reaction found=1}} |
| − | {{#set: | + | {{#set: total reaction=1}} |
| + | {{#set: completion rate=100.0}} | ||
Latest revision as of 19:32, 21 March 2018
Pathway PWY-7344
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- UDPGLUCEPIM-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
