Difference between revisions of "RXN-8759"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8759 RXN-8759] == * direction: ** REVERSIBLE * common name: ** sirohydrochlorin cobaltochelatas...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPOYL-COA SINAPOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8759 RXN-8759] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J
+
 
* common name:
 
* common name:
−
** sinapoyl-CoA
+
** sirohydrochlorin cobaltochelatase
−
* molecular weight:
+
* ec number:
−
** 969.7   
+
** [http://enzyme.expasy.org/EC/4.99.1.3 EC-4.99.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** sinapinoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10919]]
+
** 1 [[CO+2]][c] '''+''' 1 [[DIHYDROSIROHYDROCHLORIN]][c] '''<=>''' 4 [[PROTON]][c] '''+''' 1 [[CPD-9039]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-1124]]
+
** 1 Co2+[c] '''+''' 1 precorrin-2[c] '''<=>''' 4 H+[c] '''+''' 1 cobalt-precorrin-2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_002430]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229225 44229225]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26269 26269]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57393 57393]
+
{{#set: common name=sirohydrochlorin cobaltochelatase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-4.99.1.3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00411 C00411]
+
{{#set: gene associated=Ec-10_002430}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=C(OC)C(O)=C(OC)C=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=RBFUWESMWRUGFY-GSNIOFLCSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=sinapoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: molecular weight=969.7    }}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=sinapinoyl-CoA}}
+
−
{{#set: produced by=RXN-10919}}
+
−
{{#set: reversible reaction associated=RXN-1124}}
+

Latest revision as of 19:33, 21 March 2018

Reaction RXN-8759

  • direction:
    • REVERSIBLE
  • common name:
    • sirohydrochlorin cobaltochelatase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8759&oldid=27679"