Difference between revisions of "CPD-12905"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_004790 == * left end position: ** 5683400 * transcription direction: ** POSITIVE * right end position: ** 5694615 * centisome position: ** 87.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == * smiles: ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12905 CPD-12905] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-hydroxy-5-methylhex-4-enoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 889.657 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-11919]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986102 50986102] | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16469 C16469] |
| − | {{#set: common name= | + | * HMDB : HMDB60373 |
| − | {{#set: | + | {{#set: smiles=CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J}} |
| + | {{#set: common name=3-hydroxy-5-methylhex-4-enoyl-CoA}} | ||
| + | {{#set: molecular weight=889.657 }} | ||
| + | {{#set: produced by=RXN-11919}} | ||
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-12905
- smiles:
- CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OLZYNLSKRKFUJC-FPVIQYCMSA-J
- common name:
- 3-hydroxy-5-methylhex-4-enoyl-CoA
- molecular weight:
- 889.657
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
