Difference between revisions of "CHOLINE-BETAINE-ANA-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * smiles: ** CN2(C=NC1(=C(C(NC(N(C)1)=O)=O)2)) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-BETAINE-ANA-PWY CHOLINE-BETAINE-ANA-PWY] == * taxonomic range: ** [http://metacyc.org/META/NE...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-BETAINE-ANA-PWY CHOLINE-BETAINE-ANA-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
* common name: | * common name: | ||
− | ** | + | ** choline degradation I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** choline betaine anabolism |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[BADH-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Ec-20_003790]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[CHD-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-00_005920]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=choline degradation I}} | |
− | + | {{#set: common name=choline betaine anabolism}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Contents
Pathway CHOLINE-BETAINE-ANA-PWY
- taxonomic range:
- common name:
- choline degradation I
- Synonym(s):
- choline betaine anabolism
Reaction(s) found
2 reactions found over 2 reactions in the full pathway
- BADH-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- CHD-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: