Difference between revisions of "RXN66-1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-1 RXN66-1] == * direction: ** LEFT-TO-RIGHT * common name: ** Catalase-peroxidase haem ** Hae...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-1 RXN66-1] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
+
 
* common name:
 
* common name:
−
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
+
** Catalase-peroxidase haem
−
* molecular weight:
+
** Haem peroxidase, plant/fungal/bacterial
−
** 427.646   
+
** Catalase core domain
 +
** Catalase
 +
** Haem peroxidase
 +
** catalase/peroxidase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.6 EC-1.11.1.6]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-318]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[ETOH]][c] '''=>''' 1 [[ACETALD]][c] '''+''' 2 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 hydrogen peroxide[c] '''+''' 1 ethanol[c] '''=>''' 1 acetaldehyde[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-00_010030]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-05_003380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_008210]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-07_001420]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_008240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-02_000470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_008230]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-07_004600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-11_003410]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-162]], ethanol degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-162 PWY66-162]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
+
{{#set: common name=Catalase-peroxidase haem}}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: common name=Haem peroxidase, plant/fungal/bacterial}}
−
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
+
{{#set: common name=Catalase core domain}}
−
{{#set: common name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}}
+
{{#set: common name=Catalase}}
−
{{#set: molecular weight=427.646    }}
+
{{#set: common name=Haem peroxidase}}
−
{{#set: consumed by=RXN66-318}}
+
{{#set: common name=catalase/peroxidase}}
 +
{{#set: ec number=EC-1.11.1.6}}
 +
{{#set: gene associated=Ec-00_010030|Ec-05_003380|Ec-00_008210|Ec-07_001420|Ec-00_008240|Ec-02_000470|Ec-00_008230|Ec-07_004600|Ec-11_003410}}
 +
{{#set: in pathway=PWY66-162}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:33, 21 March 2018

Reaction RXN66-1

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Catalase-peroxidase haem
    • Haem peroxidase, plant/fungal/bacterial
    • Catalase core domain
    • Catalase
    • Haem peroxidase
    • catalase/peroxidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 hydrogen peroxide[c] + 1 ethanol[c] => 1 acetaldehyde[c] + 2 H2O[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-162, ethanol degradation IV: PWY66-162
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-1&oldid=27757"