Difference between revisions of "Ec-12 005020"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2) *...")
(Created page with "Category:Gene == Gene Ec-12_005020 == * left end position: ** 4606004 * transcription direction: ** POSITIVE * right end position: ** 4608952 * centisome position: ** 55.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
+
== Gene Ec-12_005020 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
+
** 4606004
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
+
** 4608952
−
* molecular weight:
+
* centisome position:
−
** 352.197    
+
** 55.254025    
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
+
** Esi_0287_0011
−
** 5-amino-6-(5'-phosphoribosylamino)uracil
+
** Esi0287_0011
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* Reaction: [[1.14.11.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RIBOFLAVINSYNDEAM-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4606004}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4608952}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
+
{{#set: centisome position=55.254025   }}
−
* BIGG : 37234
+
{{#set: common name=Esi_0287_0011|Esi0287_0011}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=1.14.11.2-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)}}
+
−
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
+
−
{{#set: molecular weight=352.197   }}
+
−
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
+
−
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
+
−
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}
+

Latest revision as of 19:33, 21 March 2018

Gene Ec-12_005020

  • left end position:
    • 4606004
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4608952
  • centisome position:
    • 55.254025
  • Synonym(s):
    • Esi_0287_0011
    • Esi0287_0011

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-12_005020&oldid=27766"