Difference between revisions of "CPD-602"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14268 RXN-14268] == * direction: ** LEFT-TO-RIGHT * common name: ** lauroyl-CoA acetyl-CoA acyl...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2) *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14268 RXN-14268] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
 +
* inchi key:
 +
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
 
* common name:
 
* common name:
−
** lauroyl-CoA acetyl-CoA acyltransferase
+
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
+
** 352.197   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
 +
** 5-amino-6-(5'-phosphoribosylamino)uracil
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBOFLAVINSYNREDUC-RXN]]
−
** 1 [[CPD-10284]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[LAUROYLCOA-CPD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RIBOFLAVINSYNDEAM-RXN]]
−
** 1 3-oxo-myristoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 lauroyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-26_003940]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
+
−
** '''5''' reactions found over '''11''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31093 31093]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03858 R03858]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* BIGG : 37234
−
{{#set: common name=lauroyl-CoA acetyl-CoA acyltransferase}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.16}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
−
{{#set: gene associated=Ec-26_003940}}
+
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)}}
−
{{#set: in pathway=PWY-7654}}
+
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
−
{{#set: reconstruction source=orthology-aragem}}
+
{{#set: molecular weight=352.197    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
 +
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
 +
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-602

  • smiles:
    • C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)
  • inchi key:
    • InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
  • common name:
    • 5-amino-6-(5-phospho-D-ribosylamino)uracil
  • molecular weight:
    • 352.197
  • Synonym(s):
    • 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
    • 5-amino-6-(5'-phosphoribosylamino)uracil

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C2(OC(NC1(=C(N)C(=O)NC(=O)N1))C(O)C(O)2)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-602&oldid=27787"