Difference between revisions of "PWY-6012-1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** acyl carrier protein activation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** [acp] metabolism | ||
+ | ** ACP metabolism | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''1''' reactions in the full pathway | |
− | * [[ | + | * [[HOLO-ACP-SYNTH-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Ec-06_004620]] | ||
+ | *** [[Ec-01_000130]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=acyl carrier protein activation}} | |
− | + | {{#set: common name=[acp] metabolism|ACP metabolism}} | |
− | + | {{#set: reaction found=1}} | |
− | {{#set: | + | {{#set: total reaction=1}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:33, 21 March 2018
Pathway PWY-6012-1
- taxonomic range:
- common name:
- acyl carrier protein activation
- Synonym(s):
- [acp] metabolism
- ACP metabolism
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- HOLO-ACP-SYNTH-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
"acp] metabolism" cannot be used as a page name in this wiki.