Difference between revisions of "PWY-6012-1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * in...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TA...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6012-1 PWY-6012-1] ==
−
* smiles:
+
* taxonomic range:
−
** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
+
 
* common name:
 
* common name:
−
** dihydrozeatin-O-glucoside
+
** acyl carrier protein activation
−
* molecular weight:
+
−
** 383.403   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** [acp] metabolism
 +
** ACP metabolism
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''1''' reactions in the full pathway
−
* [[RXN-4726]]
+
* [[HOLO-ACP-SYNTH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Ec-06_004620]]
 +
*** [[Ec-01_000130]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658286 90658286]
+
{{#set: taxonomic range=TAX-2759}}
−
* LIGAND-CPD:
+
{{#set: common name=acyl carrier protein activation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448]
+
{{#set: common name=[acp] metabolism|ACP metabolism}}
−
* HMDB : HMDB12214
+
{{#set: reaction found=1}}
−
{{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}}
+
{{#set: total reaction=1}}
−
{{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}}
+
{{#set: completion rate=100.0}}
−
{{#set: common name=dihydrozeatin-O-glucoside}}
+
−
{{#set: molecular weight=383.403    }}
+
−
{{#set: produced by=RXN-4726}}
+

Latest revision as of 19:33, 21 March 2018

Pathway PWY-6012-1

  • taxonomic range:
  • common name:
    • acyl carrier protein activation
  • Synonym(s):
    • [acp] metabolism
    • ACP metabolism

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links

"acp] metabolism" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6012-1&oldid=27788"