Difference between revisions of "CPD-14705"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-28_003310 == * Synonym(s): ** Esi_0009_0081 ** Esi0009_0081 == Reactions associated == * RXN-7828 ** pantograph-aragem * RXN-8228...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == |
+ | * smiles: | ||
+ | ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate | ||
+ | * molecular weight: | ||
+ | ** 334.43 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[RXN- | + | * [[RXN-13677]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346] |
− | {{#set: | + | {{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}} |
+ | {{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}} | ||
+ | {{#set: molecular weight=334.43 }} | ||
+ | {{#set: consumed by=RXN-13677}} |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-14705
- smiles:
- CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
- inchi key:
- InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
- common name:
- 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
- molecular weight:
- 334.43
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.
"4-hydroxy-2-nonenal-[Cys-Gly] conjugate" cannot be used as a page name in this wiki.