Difference between revisions of "L-seryl-SEC-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-seryl-SEC-tRNAs L-seryl-SEC-tRNAs] == * common name: ** an L-seryl-[tRNAsec] * Synonym(s): =...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-seryl-SEC-tRNAs L-seryl-SEC-tRNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an L-seryl-[tRNAsec] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-2161]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-10038]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=an L-seryl-[tRNAsec]}} | |
| − | + | {{#set: produced by=RXN0-2161}} | |
| − | + | {{#set: reversible reaction associated=RXN-10038}} | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: reversible reaction associated=RXN- | + | |
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite L-seryl-SEC-tRNAs
- common name:
- an L-seryl-[tRNAsec]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an L-seryl-[tRNAsec" cannot be used as a page name in this wiki.
