Difference between revisions of "2.7.1.127-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.127-RXN 2.7.1.127-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** inositol-1,4,5-tris...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.127-RXN 2.7.1.127-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** inositol-1,4,5-trisphosphate 3-kinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.127 EC-2.7.1.127] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[INOSITOL-1-4-5-TRISPHOSPHATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[CPD-506]][c] |
− | == | + | * With common name(s): |
+ | ** 1 D-myo-inositol (1,4,5)-trisphosphate[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-16_003350]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-6364]], D-myo-inositol (1,3,4)-trisphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6364 PWY-6364] | ||
+ | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-6362]], 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6362 PWY-6362] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6361]], 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6361 PWY-6361] | ||
+ | ** '''2''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11020 11020] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03433 R03433] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/P23677 P23677] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P17105 P17105] |
− | * | + | ** [http://www.uniprot.org/uniprot/P42335 P42335] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O45049 O45049] |
− | * | + | ** [http://www.uniprot.org/uniprot/O45050 O45050] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O45051 O45051] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=inositol-1,4,5-trisphosphate 3-kinase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.1.127}} |
− | {{#set: | + | {{#set: gene associated=Ec-16_003350}} |
− | {{#set: | + | {{#set: in pathway=PWY-6364|PWY-6362|PWY-6361}} |
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:34, 21 March 2018
Contents
Reaction 2.7.1.127-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- inositol-1,4,5-trisphosphate 3-kinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 INOSITOL-1-4-5-TRISPHOSPHATE[c] + 1 ATP[c] => 1 PROTON[c] + 1 ADP[c] + 1 CPD-506[c]
- With common name(s):
- 1 D-myo-inositol (1,4,5)-trisphosphate[c] + 1 ATP[c] => 1 H+[c] + 1 ADP[c] + 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-16_003350
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
- PWY-6364, D-myo-inositol (1,3,4)-trisphosphate biosynthesis: PWY-6364
- 1 reactions found over 3 reactions in the full pathway
- PWY-6362, 1D-myo-inositol hexakisphosphate biosynthesis II (mammalian): PWY-6362
- 4 reactions found over 5 reactions in the full pathway
- PWY-6361, 1D-myo-inositol hexakisphosphate biosynthesis I (from Ins(1,4,5)P3): PWY-6361
- 2 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links