Difference between revisions of "PWY-3941"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3941 PWY-3941] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3941 PWY-3941] ==
−
* smiles:
+
* taxonomic range:
−
** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
+
** β-alanine biosynthesis II
−
* molecular weight:
+
−
** 1037.905   
+
 
* Synonym(s):
 
* Synonym(s):
−
** OPC8-trans-2-enoyl-CoA
+
** β-alanine biosynthesis from proprionate
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-10697]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-6383]]
−
* [[RXN-10696]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-14_006530]]
 +
*** [[Ec-17_000320]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2.6.1.18-RXN 2.6.1.18-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPROPIONATE-DEHYDROGENASE-RXN 3-HYDROXYPROPIONATE-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PROPCOASYN-RXN PROPCOASYN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PROPIONATE--COA-LIGASE-RXN PROPIONATE--COA-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6384 RXN-6384]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209]
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: common name=β-alanine biosynthesis II}}
−
{{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}}
+
{{#set: common name=β-alanine biosynthesis from proprionate}}
−
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}}
+
{{#set: reaction found=1}}
−
{{#set: molecular weight=1037.905    }}
+
{{#set: total reaction=6}}
−
{{#set: common name=OPC8-trans-2-enoyl-CoA}}
+
{{#set: completion rate=17.0}}
−
{{#set: consumed by=RXN-10697}}
+
−
{{#set: produced by=RXN-10696}}
+

Latest revision as of 19:34, 21 March 2018

Pathway PWY-3941

  • taxonomic range:
  • common name:
    • β-alanine biosynthesis II
  • Synonym(s):
    • β-alanine biosynthesis from proprionate

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-3941&oldid=27904"