Difference between revisions of "PWY-4361"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4361 PWY-4361] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4361 PWY-4361] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] | ||
* common name: | * common name: | ||
− | ** | + | ** S-methyl-5-thio-α-D-ribose 1-phosphate degradation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | * [[R147-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
− | * [[RXN- | + | *** [[Ec-20_000070]] |
− | * [[RXN- | + | ** 1 reconstruction source(s) associated: |
− | = | + | *** [[annotation-esiliculosus_genome]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=5.3.1.23-RXN 5.3.1.23-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R145-RXN R145-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R82-RXN R82-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R83-RXN R83-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13072 RXN-13072] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15650 RXN-15650] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-3193}} | |
− | + | {{#set: common name=S-methyl-5-thio-α-D-ribose 1-phosphate degradation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=14.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:34, 21 March 2018
Pathway PWY-4361
- taxonomic range:
- common name:
- S-methyl-5-thio-α-D-ribose 1-phosphate degradation
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- R147-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: